Information card for entry 4321077
| Formula |
C46 H46 F12 N6 Ni O4 P2 |
| Calculated formula |
C46 H46 F12 N6 Ni O4 P2 |
| SMILES |
[Ni]1234([N](c5ccc(OC)cc5)=C(C)c5[n]1c(ccc5)C(=[N]2c1ccc(OC)cc1)C)[N](c1ccc(OC)cc1)=C(C)c1[n]3c(ccc1)C(=[N]4c1ccc(OC)cc1)C.[P](F)(F)(F)(F)(F)[F-].[P](F)(F)(F)(F)(F)[F-] |
| Title of publication |
Molecular and Electronic Structures of Bis(pyridine-2,6-diimine)metal Complexes [ML2](PF6)n (n = 0, 1, 2, 3; M = Mn, Fe, Co, Ni, Cu, Zn) |
| Authors of publication |
Bas de Bruin; Eckhard Bill; Eberhard Bothe; Thomas Weyhermüller; Karl Wieghardt |
| Journal of publication |
Inorganic Chemistry |
| Year of publication |
2000 |
| Journal volume |
39 |
| Pages of publication |
2936 - 2947 |
| a |
18.047 ± 0.002 Å |
| b |
16.655 ± 0.002 Å |
| c |
17.132 ± 0.002 Å |
| α |
90° |
| β |
112.7 ± 0.02° |
| γ |
90° |
| Cell volume |
4750.5 ± 1.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0364 |
| Residual factor for significantly intense reflections |
0.0281 |
| Weighted residual factors for all reflections |
0.0698 |
| Weighted residual factors for significantly intense reflections |
0.066 |
| Goodness-of-fit parameter for all reflections |
1.037 |
| Goodness-of-fit parameter for significantly intense reflections |
1.072 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4321077.html