Information card for entry 4343105
| Formula |
C27.5 H12.5 Cl1.5 F3 N3 |
| Calculated formula |
C27.5 H12.5 Cl1.5 F3 N3 |
| SMILES |
ClC(Cl)Cl.Fc1c(c(F)c(c(F)c1C#Cc1ccncc1)C#Cc1ccncc1)C#Cc1ccncc1 |
| Title of publication |
DOSY NMR, X-ray Structural and Ion-Mobility Mass Spectrometric Studies on Electron-Deficient and Electron-Rich M6L4 Coordination Cages. |
| Authors of publication |
Bonakdarzadeh, Pia; Topić, Filip; Kalenius, Elina; Bhowmik, Sandip; Sato, Sota; Groessl, Michael; Knochenmuss, Richard; Rissanen, Kari |
| Journal of publication |
Inorganic chemistry |
| Year of publication |
2015 |
| Journal volume |
54 |
| Journal issue |
12 |
| Pages of publication |
6055 - 6061 |
| a |
13.558 ± 0.0001 Å |
| b |
20.4595 ± 0.0002 Å |
| c |
33.6987 ± 0.0002 Å |
| α |
90° |
| β |
98.9012 ± 0.0007° |
| γ |
90° |
| Cell volume |
9235.1 ± 0.13 Å3 |
| Cell temperature |
123 ± 0.1 K |
| Ambient diffraction temperature |
123 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.042 |
| Residual factor for significantly intense reflections |
0.0357 |
| Weighted residual factors for significantly intense reflections |
0.0951 |
| Weighted residual factors for all reflections included in the refinement |
0.1001 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4343105.html