Information card for entry 4345469
| Formula |
C14 H19 Cl2 Cu N5 O8 |
| Calculated formula |
C14 H19 Cl2 Cu N5 O8 |
| SMILES |
[Cu]12([NH](CCc3[n]1cccc3)Cc1[n]2ccn1C)[N]#CC.Cl(=O)(=O)(=O)[O-].Cl(=O)(=O)(=O)[O-] |
| Title of publication |
Copper Complexes as Bioinspired Models for Lytic Polysaccharide Monooxygenases. |
| Authors of publication |
Concia, Alda Lisa; Beccia, Maria Rosa; Orio, Maylis; Ferre, Francine Terra; Scarpellini, Marciela; Biaso, Frédéric; Guigliarelli, Bruno; Réglier, Marius; Simaan, A. Jalila |
| Journal of publication |
Inorganic chemistry |
| Year of publication |
2017 |
| Journal volume |
56 |
| Journal issue |
3 |
| Pages of publication |
1023 - 1026 |
| a |
8.8001 ± 0.0003 Å |
| b |
10.4679 ± 0.0003 Å |
| c |
11.3132 ± 0.0003 Å |
| α |
84.583 ± 0.002° |
| β |
79.429 ± 0.003° |
| γ |
83.371 ± 0.003° |
| Cell volume |
1014.75 ± 0.05 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0363 |
| Residual factor for significantly intense reflections |
0.0348 |
| Weighted residual factors for significantly intense reflections |
0.095 |
| Weighted residual factors for all reflections included in the refinement |
0.0966 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.071 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4345469.html