Information card for entry 4346195
| Common name |
09170b |
| Formula |
C18 H36 Cl2 Fe N6 O8 |
| Calculated formula |
C18 H36 Cl2 Fe N6 O8 |
| SMILES |
[Fe]123([N]4(CCC[N]51CC[N]2(CCC[N]3(CC4)CC5)C)C)([N]#CC)[N]#CC.Cl(=O)(=O)(=O)[O-].Cl(=O)(=O)(=O)[O-] |
| Title of publication |
Oxoiron(IV) Complex of the Ethylene-Bridged Dialkylcyclam Ligand Me2EBC. |
| Authors of publication |
England, Jason; Prakash, Jai; Cranswick, Matthew A.; Mandal, Debasish; Guo, Yisong; Münck, Eckard; Shaik, Sason; Que, Jr, Lawrence |
| Journal of publication |
Inorganic chemistry |
| Year of publication |
2015 |
| Journal volume |
54 |
| Journal issue |
16 |
| Pages of publication |
7828 - 7839 |
| a |
18.193 ± 0.005 Å |
| b |
8.555 ± 0.002 Å |
| c |
18.344 ± 0.005 Å |
| α |
90° |
| β |
117.781 ± 0.003° |
| γ |
90° |
| Cell volume |
2526 ± 1.1 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0648 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.145 |
| Weighted residual factors for all reflections included in the refinement |
0.1515 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4346195.html