Information card for entry 4346716
| Formula |
C36 H72 N4 Nb |
| Calculated formula |
C36 H72 N4 Nb |
| SMILES |
C(C(C)(C)C)(=N[Nb](N=C(C(C)(C)C)C(C)(C)C)(N=C(C(C)(C)C)C(C)(C)C)N=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Title of publication |
Quantifying the Electron Donor and Acceptor Abilities of the Ketimide Ligands in M(N═C(t)Bu2)4 (M = V, Nb, Ta). |
| Authors of publication |
Damon, Peter L.; Liss, Cameron J.; Lewis, Richard A.; Morochnik, Simona; Szpunar, David E.; Telser, Joshua; Hayton, Trevor W. |
| Journal of publication |
Inorganic chemistry |
| Year of publication |
2015 |
| Journal volume |
54 |
| Journal issue |
20 |
| Pages of publication |
10081 - 10095 |
| a |
16.5514 ± 0.001 Å |
| b |
15.5926 ± 0.0008 Å |
| c |
15.375 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3968 ± 0.4 Å3 |
| Cell temperature |
103 ± 2 K |
| Ambient diffraction temperature |
103 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
52 |
| Hermann-Mauguin space group symbol |
P n n a |
| Hall space group symbol |
-P 2a 2bc |
| Residual factor for all reflections |
0.0883 |
| Residual factor for significantly intense reflections |
0.0396 |
| Weighted residual factors for significantly intense reflections |
0.0533 |
| Weighted residual factors for all reflections included in the refinement |
0.0584 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.282 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4346716.html