Information card for entry 4348417
| Formula |
C22 H21 N3 O |
| Calculated formula |
C22 H21 N3 O |
| SMILES |
O=C(/N=C(\Nc1ccc(cc1)C)NCc1ccccc1)c1ccccc1 |
| Title of publication |
DNA/protein binding, DNA cleavage, cytotoxicity, superoxide radical scavenging and molecular docking studies of copper(ii) complexes containing N-benzyl-N′-aryl-N′′-benzoylguanidine ligands |
| Authors of publication |
Jeyalakshmi, Kumaramangalam; Arun, Yuvaraj; Bhuvanesh, Nattamai S. P.; Perumal, Paramasivan Thirumalai; Sreekanth, Anandaram; Karvembu, Ramasamy |
| Journal of publication |
Inorganic Chemistry Frontiers |
| Year of publication |
2015 |
| Journal volume |
2 |
| Journal issue |
8 |
| Pages of publication |
780 |
| a |
12.6374 ± 0.0015 Å |
| b |
12.789 ± 0.0015 Å |
| c |
12.804 ± 0.0015 Å |
| α |
73.447 ± 0.002° |
| β |
75.957 ± 0.002° |
| γ |
74.303 ± 0.002° |
| Cell volume |
1878.7 ± 0.4 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0513 |
| Residual factor for significantly intense reflections |
0.0424 |
| Weighted residual factors for significantly intense reflections |
0.1098 |
| Weighted residual factors for all reflections included in the refinement |
0.1153 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4348417.html
