Information card for entry 4503094
| Chemical name |
4,4,8,8-tetrafluoro-2,6-diiodopyrazabole |
| Formula |
C6 H4 B2 F4 I2 N4 |
| Calculated formula |
C6 H4 B2 F4 I2 N4 |
| SMILES |
Ic1cn2[B](F)(F)[n]3cc(cn3[B](F)(F)[n]2c1)I |
| Title of publication |
The Boat Conformation in Pyrazaboles. A Theoretical and Experimental Study† |
| Authors of publication |
Cavero, Emma; Giménez, Raquel; Uriel, Santiago; Beltrán, Eduardo; Serrano, José Luis; Alkorta, Ibon; Elguero, José |
| Journal of publication |
Crystal Growth & Design |
| Year of publication |
2008 |
| Journal volume |
8 |
| Journal issue |
3 |
| Pages of publication |
838 |
| a |
24.106 ± 0.009 Å |
| b |
4.717 ± 0.002 Å |
| c |
13.759 ± 0.005 Å |
| α |
90° |
| β |
119.86 ± 0.02° |
| γ |
90° |
| Cell volume |
1356.8 ± 1 Å3 |
| Cell temperature |
295 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0645 |
| Residual factor for significantly intense reflections |
0.0583 |
| Weighted residual factors for significantly intense reflections |
0.1592 |
| Weighted residual factors for all reflections included in the refinement |
0.17 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.071 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4503094.html