Information card for entry 4506418
| Formula |
C15 H9 F4 I O3 S2 |
| Calculated formula |
C15 H9 F4 I O3 S2 |
| SMILES |
Ic1c(F)c(F)c(Oc2ccc(S(=O)(=O)CC3SC3)cc2)c(F)c1F |
| Title of publication |
Structure-Activity Relationship for Thiirane-Based Gelatinase Inhibitors. |
| Authors of publication |
Lee, Mijoon; Ikejiri, Masahiro; Klimpel, Dennis; Toth, Marta; Espahbodi, Mana; Hesek, Dusan; Forbes, Christopher; Kumarasiri, Malika; Noll, Bruce C.; Chang, Mayland; Mobashery, Shahriar |
| Journal of publication |
ACS medicinal chemistry letters |
| Year of publication |
2012 |
| Journal volume |
3 |
| Journal issue |
6 |
| Pages of publication |
490 - 495 |
| a |
16.9301 ± 0.0008 Å |
| b |
5.6351 ± 0.0003 Å |
| c |
18.5698 ± 0.0008 Å |
| α |
90° |
| β |
111.768 ± 0.002° |
| γ |
90° |
| Cell volume |
1645.28 ± 0.14 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0273 |
| Residual factor for significantly intense reflections |
0.0266 |
| Weighted residual factors for significantly intense reflections |
0.0645 |
| Weighted residual factors for all reflections included in the refinement |
0.0648 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.14 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4506418.html