Information card for entry 4513028
| Formula |
C15 H B Br3 F18 N6 Tl |
| Calculated formula |
C15 H B Br3 F18 N6 Tl |
| SMILES |
[Tl]12[n]3n(c(c(Br)c3C(F)(F)F)C(F)(F)F)[BH](n3[n]1c(c(Br)c3C(F)(F)F)C(F)(F)F)n1[n]2c(c(Br)c1C(F)(F)F)C(F)(F)F |
| Title of publication |
Discovering Copper for Methane C–H Bond Functionalization |
| Authors of publication |
Gava, Riccardo; Olmos, Andrea; Noverges, Bárbara; Varea, Teresa; Álvarez, Eleuterio; Belderrain, Tomás R.; Caballero, Ana; Asensio, Gregorio; Pérez, Pedro J. |
| Journal of publication |
ACS Catalysis |
| Year of publication |
2015 |
| Journal volume |
5 |
| Journal issue |
6 |
| Pages of publication |
3726 |
| a |
9.4814 ± 0.0008 Å |
| b |
10.765 ± 0.0009 Å |
| c |
13.9827 ± 0.0011 Å |
| α |
111.406 ± 0.002° |
| β |
92.343 ± 0.002° |
| γ |
99.301 ± 0.002° |
| Cell volume |
1303.49 ± 0.19 Å3 |
| Cell temperature |
213 ± 2 K |
| Ambient diffraction temperature |
213 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0451 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.1142 |
| Weighted residual factors for all reflections included in the refinement |
0.1165 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4513028.html