Information card for entry 4514611
| Formula |
C29 H33 B O4 Si |
| Calculated formula |
C29 H33 B O4 Si |
| SMILES |
[SiH]([C@H]1[C@](C1)(C(=O)OC)c1ccc(cc1)B1OC(C(O1)(C)C)(C)C)(c1ccccc1)c1ccccc1 |
| Title of publication |
Enantioselective Rhodium-Catalyzed Desymmetric Hydrosilylation of Cyclopropenes |
| Authors of publication |
Zhao, Zhi-Yuan; Nie, Yi-Xue; Tang, Ren-He; Yin, Guan-Wu; Cao, Jian; Xu, Zheng; Cui, Yu-Ming; Zheng, Zhan-Jiang; Xu, Li-Wen |
| Journal of publication |
ACS Catalysis |
| Year of publication |
2019 |
| Journal volume |
9 |
| Journal issue |
10 |
| Pages of publication |
9110 |
| a |
6.264 ± 0.002 Å |
| b |
9.621 ± 0.004 Å |
| c |
11.639 ± 0.004 Å |
| α |
91.385 ± 0.006° |
| β |
96.47 ± 0.006° |
| γ |
100.453 ± 0.006° |
| Cell volume |
684.7 ± 0.4 Å3 |
| Cell temperature |
150.15 K |
| Ambient diffraction temperature |
150.15 K |
| Number of distinct elements |
5 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.0716 |
| Residual factor for significantly intense reflections |
0.0564 |
| Weighted residual factors for significantly intense reflections |
0.1388 |
| Weighted residual factors for all reflections included in the refinement |
0.1493 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4514611.html