Information card for entry 4514882
| Formula |
C17 H15 Cl O5 |
| Calculated formula |
C17 H15 Cl O5 |
| SMILES |
Clc1ccc(cc1)C1=CC[C@H]2C=C([C@@H](OC1)OC2=O)C(=O)OC |
| Title of publication |
Enantioselective Synthesis of Chiral Medium-Sized Cyclic Compounds via Tandem Cycloaddition/Cope Rearrangement Strategy |
| Authors of publication |
Gao, Xing; Xia, Miaoren; Yuan, Chunhao; Zhou, Leijie; Sun, Wei; Li, Cheng; Wu, Bo; Zhu, Dongyu; Zhang, Cheng; Zheng, Bing; Wang, Dongqi; Guo, Hongchao |
| Journal of publication |
ACS Catalysis |
| Year of publication |
2019 |
| Journal volume |
9 |
| Journal issue |
3 |
| Pages of publication |
1645 |
| a |
6.1976 ± 0.0017 Å |
| b |
17.271 ± 0.005 Å |
| c |
7.158 ± 0.002 Å |
| α |
90° |
| β |
103.688 ± 0.003° |
| γ |
90° |
| Cell volume |
744.4 ± 0.4 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173.15 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0284 |
| Residual factor for significantly intense reflections |
0.0282 |
| Weighted residual factors for significantly intense reflections |
0.0719 |
| Weighted residual factors for all reflections included in the refinement |
0.0722 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.072 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4514882.html