Information card for entry 4515484
| Chemical name |
YSB-! |
| Formula |
C23 H22 N2 O4 S2 |
| Calculated formula |
C23 H22 N2 O4 S2 |
| SMILES |
S(=O)(=O)(c1ccccc1)N(S(=O)(=O)c1ccccc1)CC[C@H](c1ccc(cc1)C)C#N |
| Title of publication |
Copper-Catalyzed Asymmetric Aminocyanation of Arylcyclopropanes for Synthesis of γ-Amino Nitriles |
| Authors of publication |
Yang, Shengbiao; Wang, Lihong; Zhang, Hongwei; Liu, Chunyang; Zhang, Linli; Wang, Xiaomin; Zhang, Ge; Li, Yan; Zhang, Qian |
| Journal of publication |
ACS Catalysis |
| Year of publication |
2018 |
| Journal volume |
9 |
| Journal issue |
1 |
| Pages of publication |
716 |
| a |
9.0036 ± 0.0009 Å |
| b |
10.9036 ± 0.0011 Å |
| c |
11.9944 ± 0.0012 Å |
| α |
103.063 ± 0.005° |
| β |
98.741 ± 0.005° |
| γ |
91.068 ± 0.005° |
| Cell volume |
1132 ± 0.2 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
5 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.0519 |
| Residual factor for significantly intense reflections |
0.0391 |
| Weighted residual factors for significantly intense reflections |
0.0886 |
| Weighted residual factors for all reflections included in the refinement |
0.0966 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4515484.html
