Information card for entry 4515903
| Formula |
C19 H18 Cl2 Cu N2 O2 |
| Calculated formula |
C19 H18 Cl2 Cu N2 O2 |
| SMILES |
[Cu]123[N](=Cc4c(ccc(Cl)c4)O2)CC(C[N]1=Cc1cc(Cl)ccc1O3)(C)C |
| Title of publication |
Bioactive Heterometallic Cu<sup>II</sup>-Zn<sup>II</sup> Complexes with Potential Biomedical Applications. |
| Authors of publication |
Majumder, Ishani; Chakraborty, Prateeti; Álvarez, Raquel; Gonzalez-Diaz, Myriam; Peláez, Rafael; Ellahioui, Younes; Bauza, Antonio; Frontera, Antonio; Zangrando, Ennio; Gómez-Ruiz, Santiago; Das, Debasis |
| Journal of publication |
ACS omega |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
10 |
| Pages of publication |
13343 - 13353 |
| a |
6.9256 ± 0.0003 Å |
| b |
23.3181 ± 0.001 Å |
| c |
11.7998 ± 0.0005 Å |
| α |
90° |
| β |
103.829 ± 0.002° |
| γ |
90° |
| Cell volume |
1850.34 ± 0.14 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0603 |
| Residual factor for significantly intense reflections |
0.0455 |
| Weighted residual factors for significantly intense reflections |
0.1261 |
| Weighted residual factors for all reflections included in the refinement |
0.138 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4515903.html
