Information card for entry 4516483
| Chemical name |
cyclo(L-Tyrosine-L-Alanine) hydrate |
| Formula |
C12 H16 N2 O4 |
| Calculated formula |
C12 H16 N2 O4 |
| SMILES |
[C@@H]1(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N1)C.O |
| Title of publication |
Cyclic Dipeptides as Building Units of Nano- and Microdevices: Synthesis, Properties, and Structural Studies |
| Authors of publication |
Jeziorna, Agata; Stopczyk, Karolina; Skorupska, Ewa; Luberda-Durnas, Katarzyna; Oszajca, Marcin; Lasocha, Wiesław; Górecki, Marcin; Frelek, Jadwiga; Potrzebowski, Marek J. |
| Journal of publication |
Crystal Growth & Design |
| Year of publication |
2015 |
| Journal volume |
15 |
| Journal issue |
10 |
| Pages of publication |
5138 |
| a |
11.1237 ± 0.0005 Å |
| b |
6.1915 ± 0.0003 Å |
| c |
8.9145 ± 0.0005 Å |
| α |
90° |
| β |
100.561 ± 0.004° |
| γ |
90° |
| Cell volume |
603.56 ± 0.05 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0645 |
| Residual factor for significantly intense reflections |
0.0643 |
| Weighted residual factors for significantly intense reflections |
0.0865 |
| Weighted residual factors for all reflections included in the refinement |
0.0865 |
| Goodness-of-fit parameter for all reflections |
6.29 |
| Method of determination |
powder diffraction |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4516483.html