Information card for entry 4517388
| Formula |
C27 H29 B Br2 |
| Calculated formula |
C27 H29 B Br2 |
| SMILES |
Brc1ccc2B(c3c(c2c1)cc(Br)cc3)c1c(cc(cc1C(C)C)C(C)C)C(C)C |
| Title of publication |
Tunable Conjugated Organoborane Oligomers for Visible-Light-Driven Hydrogen Evolution |
| Authors of publication |
Ru, Chenglong; Wei, Qiuyu; Chen, Wenhao; Guan, Qiye; Zhang, Qianqian; Ling, Yuan; Tao, Chunlan; Qin, Dongdong; Wu, Jincai; Pan, Xiaobo |
| Journal of publication |
ACS Energy Letters |
| Year of publication |
2020 |
| Journal volume |
5 |
| Journal issue |
2 |
| Pages of publication |
669 - 675 |
| a |
9.1165 ± 0.0008 Å |
| b |
10.8798 ± 0.0013 Å |
| c |
13.0957 ± 0.0015 Å |
| α |
73.946 ± 0.01° |
| β |
88.38 ± 0.008° |
| γ |
77.43 ± 0.009° |
| Cell volume |
1217.6 ± 0.2 Å3 |
| Cell temperature |
181 ± 13 K |
| Ambient diffraction temperature |
181 ± 13 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.063 |
| Residual factor for significantly intense reflections |
0.0415 |
| Weighted residual factors for significantly intense reflections |
0.0785 |
| Weighted residual factors for all reflections included in the refinement |
0.0871 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4517388.html
