Information card for entry 4519242
| Formula |
C19 H19 N O |
| Calculated formula |
C19 H19 N O |
| SMILES |
O=C1N(c2ccccc2[C@]21CC[C@H](c1c2cccc1)C)C |
| Title of publication |
Enantioselective Dearomative Mizoroki–Heck Reaction of Naphthalenes |
| Authors of publication |
Han, Xiao-Qing; Wang, Lei; Yang, Ping; Liu, Jing-Yuan; Xu, Wei-Yan; Zheng, Chao; Liang, Ren-Xiao; You, Shu-Li; Zhang, Junliang; Jia, Yi-Xia |
| Journal of publication |
ACS Catalysis |
| Year of publication |
2021 |
| Pages of publication |
655 - 661 |
| a |
11.8561 ± 0.001 Å |
| b |
10.1465 ± 0.0008 Å |
| c |
12.2213 ± 0.0011 Å |
| α |
90° |
| β |
91.807 ± 0.009° |
| γ |
90° |
| Cell volume |
1469.5 ± 0.2 Å3 |
| Cell temperature |
170 ± 2 K |
| Ambient diffraction temperature |
170 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0285 |
| Residual factor for significantly intense reflections |
0.0283 |
| Weighted residual factors for significantly intense reflections |
0.0721 |
| Weighted residual factors for all reflections included in the refinement |
0.0722 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4519242.html
