Information card for entry 7002425
| Formula |
C31 H26 I2 P2 |
| Calculated formula |
C31 H26 I2 P2 |
| SMILES |
C1[P+](c2ccccc2[P+]1(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[I-].[I-] |
| Title of publication |
Vicinal diphosphoniums: electrostatic repulsion under covalent constraint |
| Authors of publication |
Abdalilah, Mohammed; Zurawinski, Remigiuz; Canac, Yves; Laleu, Benoît; Lacour, Jérôme; Lepetit, Christine; Magro, Germinal; Bernardinelli, Gérald; Donnadieu, Bruno; Duhayon, Carine; Mikolajczyk, Marian; Chauvin, Remi |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2009 |
| Journal issue |
40 |
| Pages of publication |
8493 - 8508 |
| a |
8.8695 ± 0.0004 Å |
| b |
18.8576 ± 0.0008 Å |
| c |
34.5533 ± 0.0014 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5779.3 ± 0.4 Å3 |
| Cell temperature |
180 ± 2 K |
| Ambient diffraction temperature |
180 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0622 |
| Residual factor for significantly intense reflections |
0.0347 |
| Weighted residual factors for significantly intense reflections |
0.0618 |
| Weighted residual factors for all reflections included in the refinement |
0.0699 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.001 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7002425.html