Information card for entry 7003816
| Formula |
C30 H42 N2 Ni P2 |
| Calculated formula |
C30 H42 N2 Ni P2 |
| SMILES |
[Ni]12([P](C(C)C)(C(C)C)c3ccccc3N2c2ccccc2[P]1(C(C)C)C(C)C)Nc1ccccc1 |
| Title of publication |
Terminal nickel(ii) amide, alkoxide, and thiolate complexes containing amido diphosphine ligands of the type [N(o-C6H4PR2)2]− (R = Ph, iPr, Cy) |
| Authors of publication |
Liang, Lan-Chang; Chien, Pin-Shu; Lee, Pei-Ying; Lin, Jia-Ming; Huang, Yu-Lun |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2008 |
| Journal issue |
25 |
| Pages of publication |
3320 - 3327 |
| a |
9.455 ± 0.0002 Å |
| b |
10.722 ± 0.0002 Å |
| c |
17.768 ± 0.0005 Å |
| α |
98.228 ± 0.001° |
| β |
93.589 ± 0.001° |
| γ |
115.428 ± 0.001° |
| Cell volume |
1594.44 ± 0.07 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0707 |
| Residual factor for significantly intense reflections |
0.0573 |
| Weighted residual factors for significantly intense reflections |
0.1662 |
| Weighted residual factors for all reflections included in the refinement |
0.1818 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.741 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7003816.html
