Information card for entry 7003949
| Formula |
C18 H15 P S3 |
| Calculated formula |
C18 H15 P S3 |
| SMILES |
Sc1c(P(c2c(S)cccc2)c2c(S)cccc2)cccc1 |
| Title of publication |
Tungsten phosphanylarylthiolato complexes [W{PhP(2-SC6H4)2-κ3S,S′,P}2] and [W{P(2-SC6H4)3-κ4S,S′,S″,P}2]: Synthesis, structures and redox chemistry |
| Authors of publication |
Hildebrand, Alexandra; Lönnecke, Peter; Silaghi-Dumitrescu, Luminita; Hey-Hawkins, Evamarie |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2008 |
| Journal issue |
34 |
| Pages of publication |
4639 |
| a |
15.245 ± 0.002 Å |
| b |
7.4264 ± 0.0011 Å |
| c |
31.628 ± 0.005 Å |
| α |
90° |
| β |
103.567 ± 0.003° |
| γ |
90° |
| Cell volume |
3480.9 ± 0.9 Å3 |
| Cell temperature |
213 ± 2 K |
| Ambient diffraction temperature |
213 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0976 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.109 |
| Weighted residual factors for all reflections included in the refinement |
0.1289 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.952 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7003949.html