Information card for entry 7005505
| Common name |
2-pentamethylcyclopentadienyl-1,3-bis-mesityl-1,3,2- diazaphospholene |
| Chemical name |
2-pentamethylcyclopentadienyl-1,3-bis-mesityl-1,3,2-diazaphospholene |
| Formula |
C30 H39 N2 P |
| Calculated formula |
C30 H39 N2 P |
| SMILES |
p1(n(ccn1c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C)C1(C(=C(C(=C1C)C)C)C)C |
| Title of publication |
Structures, dynamic behaviour, and reactivity of P-cyclopentadienyl-substituted 1,3,2-diazaphospholenes |
| Authors of publication |
Sebastian Burck; Dietrich Gudat; Martin Nieger; Jürgen Tirreé |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2007 |
| Journal issue |
19 |
| Pages of publication |
1891 |
| a |
9.9703 ± 0.0002 Å |
| b |
10.6255 ± 0.0003 Å |
| c |
13.799 ± 0.0004 Å |
| α |
75.585 ± 0.001° |
| β |
85.812 ± 0.001° |
| γ |
69.263 ± 0.001° |
| Cell volume |
1323.93 ± 0.06 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0714 |
| Residual factor for significantly intense reflections |
0.044 |
| Weighted residual factors for significantly intense reflections |
0.1118 |
| Weighted residual factors for all reflections included in the refinement |
0.122 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.976 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7005505.html