Information card for entry 7006528
| Formula |
C24 H46 N6 Ti |
| Calculated formula |
C24 H46 N6 Ti |
| SMILES |
[Ti](N=C1N(C=CN1C(C)(C)C)C(C)(C)C)(N=C1N(C=CN1C(C)(C)C)C(C)(C)C)(C)C |
| Title of publication |
Imidazolin-2-iminato titanium complexes: synthesis, structure and use in ethylene polymerization catalysis. |
| Authors of publication |
Tamm, Matthias; Randoll, Sören; Herdtweck, Eberhardt; Kleigrewe, Nina; Kehr, Gerald; Erker, Gerhard; Rieger, Bernhard |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2006 |
| Journal issue |
3 |
| Pages of publication |
459 - 467 |
| a |
18.4995 ± 0.0001 Å |
| b |
16.2737 ± 0.0001 Å |
| c |
18.6379 ± 0.0001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5611.04 ± 0.05 Å3 |
| Cell temperature |
173 ± 1 K |
| Ambient diffraction temperature |
173 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0432 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for significantly intense reflections |
0.094 |
| Weighted residual factors for all reflections included in the refinement |
0.0984 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7006528.html