Information card for entry 7012626
| Formula |
C26 H26 N4 O9 V2 |
| Calculated formula |
C26 H26 N4 O9 V2 |
| SMILES |
[V]12(=O)([OH][V]3(=O)([O]=C(O1)C)(OC(=O)C)[n]1ccccc1c1[n]3cccc1)(OC(=O)C)[n]1ccccc1c1[n]2cccc1 |
| Title of publication |
Mimicking the oxidized glutathione-VIVO2+ speciesAbbreviations used: bipy, 2,2'-bipyridine; phen, 1,10-phenanthroline; H3mpg, N-(2-mercaptopropionyl)glycine; H2mpgS–S2–, the oxidized-S,S dimer of H3mpg (see Scheme 1). |
| Authors of publication |
Tolis, Evangelos J.; Manos, Manolis J.; Terzis, Aris; Raptopoulou, Catherine P.; Kabanos, Themistoklis A. |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2003 |
| Journal issue |
5 |
| Pages of publication |
775 |
| a |
20.38 ± 0.01 Å |
| b |
8.235 ± 0.004 Å |
| c |
16.64 ± 0.01 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2793 ± 3 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0575 |
| Residual factor for significantly intense reflections |
0.0446 |
| Weighted residual factors for all reflections |
0.1095 |
| Weighted residual factors for significantly intense reflections |
0.1 |
| Goodness-of-fit parameter for all reflections |
1.215 |
| Goodness-of-fit parameter for significantly intense reflections |
1.191 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7012626.html