Information card for entry 7014749
| Formula |
C15 H15 Cu N3 O3 S |
| Calculated formula |
C15 H15 Cu N3 O3 S |
| SMILES |
c1(ccc2c3c4c(ccc[n]4[Cu]([n]13)(N=C=S)(OC)[OH]C)cc2)O |
| Title of publication |
π-π Stacking and ferromagnetic coupling mechanism on a binuclear Cu(II) complex. |
| Authors of publication |
Chi, Yan-Hui; Yu, Li; Shi, Jing-Min; Zhang, Yi-Quan; Hu, Tai-Qiu; Zhang, Gui-Qiu; Shi, Wei; Cheng, Peng |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2011 |
| Journal volume |
40 |
| Journal issue |
7 |
| Pages of publication |
1453 - 1462 |
| a |
6.9794 ± 0.0015 Å |
| b |
22.703 ± 0.005 Å |
| c |
10.259 ± 0.002 Å |
| α |
90° |
| β |
105.843 ± 0.003° |
| γ |
90° |
| Cell volume |
1563.8 ± 0.6 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0746 |
| Residual factor for significantly intense reflections |
0.0535 |
| Weighted residual factors for significantly intense reflections |
0.1317 |
| Weighted residual factors for all reflections included in the refinement |
0.1399 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7014749.html