Information card for entry 7016058
| Common name |
N,N'-bis((2-methylseleno)phenylmethylene)-1,2-ethanediamine |
| Chemical name |
N,N'-bis[(2-methylseleno)phenylmethylene]-1,2-ethanediamine |
| Formula |
C18 H20 N2 Se2 |
| Calculated formula |
C18 H20 N2 Se2 |
| SMILES |
[Se](c1c(/C=N/CC/N=C/c2ccccc2[Se]C)cccc1)C |
| Title of publication |
Synthesis, characterization and coordination properties of bis(alkyl)selenosalen ligands. |
| Authors of publication |
Panda, Snigdha; Krishna, G. Rama; Reddy, C. Malla; Zade, Sanjio S. |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2011 |
| Journal volume |
40 |
| Journal issue |
25 |
| Pages of publication |
6684 - 6690 |
| a |
4.9264 ± 0.0003 Å |
| b |
7.4097 ± 0.0004 Å |
| c |
12.3868 ± 0.0007 Å |
| α |
76.344 ± 0.004° |
| β |
88.234 ± 0.004° |
| γ |
79.904 ± 0.003° |
| Cell volume |
432.55 ± 0.04 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0379 |
| Residual factor for significantly intense reflections |
0.0331 |
| Weighted residual factors for significantly intense reflections |
0.0891 |
| Weighted residual factors for all reflections included in the refinement |
0.0953 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.658 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7016058.html
