Information card for entry 7027017
| Formula |
C23 H27 Mn N2 O6 |
| Calculated formula |
C23 H27 Mn N2 O6 |
| SMILES |
[Mn]1234(Oc5c(OC)cccc5C=[N]3CCC[N]4=Cc3c(O1)c(OC)ccc3)[O]=C(O2)C(C)C |
| Title of publication |
Further attempts to rationalise the co-ordination chemistry of manganese with Schiff base ligands and supplementary carboxylate donors |
| Authors of publication |
Watkinson, Michael; Fondo, Matilde; Bermejo, Manuel R.; Sousa, Antonio; McAuliffe, Charles A.; Pritchard, Robin G.; Jaiboon, Nongnuj; Aurangzeb, Nadeem; Naeem, Mohammed |
| Journal of publication |
Journal of the Chemical Society, Dalton Transactions |
| Year of publication |
1999 |
| Journal issue |
1 |
| Pages of publication |
31 |
| a |
9.692 ± 0.002 Å |
| b |
12.088 ± 0.002 Å |
| c |
20.027 ± 0.004 Å |
| α |
90° |
| β |
99.55 ± 0.03° |
| γ |
90° |
| Cell volume |
2313.8 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1063 |
| Residual factor for significantly intense reflections |
0.1051 |
| Weighted residual factors for significantly intense reflections |
0.2923 |
| Weighted residual factors for all reflections included in the refinement |
0.2957 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.451 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7027017.html