Information card for entry 7030127
| Formula |
C22 H16 Co N2 O10 |
| Calculated formula |
C22 H16 Co N2 O10 |
| SMILES |
C1(=O)c2c(C(=O)O)cc3c([n]2[Co]2(O1)([n]1c(C(=O)O2)c(C(=O)O)cc2ccccc12)([OH2])[OH2])cccc3 |
| Title of publication |
Temperature-/solvent-dependent low-dimensional compounds based on quinoline-2,3-dicarboxylic acid: structures and fluorescent properties. |
| Authors of publication |
Wang, Ming-Fang; Hong, Xu-Jia; Zhan, Qing-Guang; Jin, Hong-Guang; Liu, Yi-Ting; Zheng, Zhi-Peng; Xu, Shi-Hai; Cai, Yue-Peng |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2012 |
| Journal volume |
41 |
| Journal issue |
38 |
| Pages of publication |
11898 - 11906 |
| a |
7.3968 ± 0.0014 Å |
| b |
9.1349 ± 0.0018 Å |
| c |
9.41 ± 0.003 Å |
| α |
110.547 ± 0.004° |
| β |
98.24 ± 0.004° |
| γ |
111.63 ± 0.002° |
| Cell volume |
525.6 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.104 |
| Residual factor for significantly intense reflections |
0.0645 |
| Weighted residual factors for significantly intense reflections |
0.1143 |
| Weighted residual factors for all reflections included in the refinement |
0.1402 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7030127.html
