Information card for entry 7030263
| Formula |
C30 H34 B N2 O4 P S |
| Calculated formula |
C30 H34 B N2 O4 P S |
| SMILES |
[P+](c1ccc(B2N(c3c(N2CC)cccc3)CC)cc1)(c1ccccc1)(c1ccccc1)C.S(=O)(=O)([O-])OC |
| Title of publication |
Syntheses of rod-shaped fluorescent 1,3,2-benzodiazaboroles with phosphonium, and phosphane chalcogenide acceptor functions. |
| Authors of publication |
Weber, Lothar; Kuhtz, Henry; Böhling, Lena; Brockhinke, Andreas; Chrostowska, Anna; Dargelos, Alain; Mazière, Audrey; Stammler, Hans-Georg; Neumann, Beate |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2012 |
| Journal volume |
41 |
| Journal issue |
34 |
| Pages of publication |
10440 - 10452 |
| a |
19.6129 ± 0.0003 Å |
| b |
8.4143 ± 0.0001 Å |
| c |
18.1021 ± 0.0002 Å |
| α |
90° |
| β |
110.722 ± 0.0007° |
| γ |
90° |
| Cell volume |
2794.11 ± 0.06 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0511 |
| Residual factor for significantly intense reflections |
0.0363 |
| Weighted residual factors for significantly intense reflections |
0.091 |
| Weighted residual factors for all reflections included in the refinement |
0.0975 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7030263.html