Information card for entry 7031562
| Formula |
C25 H18 B F2 N3 |
| Calculated formula |
C25 H18 B F2 N3 |
| SMILES |
[B]1(F)(F)[n]2cccc2=C(c2n1ccc2)C#Cc1cc2n(c3c(c2cc1)cccc3)CC |
| Title of publication |
Carbazole-BODIPY conjugates: design, synthesis, structure and properties. |
| Authors of publication |
Misra, Rajneesh; Jadhav, Thaksen; Dhokale, Bhausaheb; Gautam, Prabhat; Sharma, Rekha; Maragani, Ramesh; Mobin, Shaikh M. |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2014 |
| Journal volume |
43 |
| Journal issue |
34 |
| Pages of publication |
13076 |
| a |
5.524 ± 0.0003 Å |
| b |
13.3635 ± 0.0008 Å |
| c |
27.7672 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2049.8 ± 0.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0584 |
| Residual factor for significantly intense reflections |
0.0466 |
| Weighted residual factors for significantly intense reflections |
0.1219 |
| Weighted residual factors for all reflections included in the refinement |
0.1333 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.081 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7031562.html