Information card for entry 7034838
| Formula |
C27 H19 B F2 N2 O |
| Calculated formula |
C27 H19 B F2 N2 O |
| SMILES |
F[B]1(F)Oc2ccccc2c2n(c3ccccc3)c(c([n]12)c1ccccc1)c1ccccc1 |
| Title of publication |
Design, synthesis, photophysical and electrochemical properties of 2-(4,5-diphenyl-1-p-aryl-1H-imidazol-2-yl)phenol-based boron complexes. |
| Authors of publication |
Mukundam, Vanga; Dhanunjayarao, Kunchala; Chuang, Ching-Nan; Kang, Dun-Yen; Leung, Man-Kit; Hsieh, Kuo-Huang; Venkatasubbaiah, Krishnan |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2015 |
| Journal volume |
44 |
| Journal issue |
22 |
| Pages of publication |
10228 - 10236 |
| a |
10.2847 ± 0.0004 Å |
| b |
10.8082 ± 0.0004 Å |
| c |
10.9755 ± 0.0004 Å |
| α |
85.101 ± 0.003° |
| β |
75.591 ± 0.003° |
| γ |
67.342 ± 0.002° |
| Cell volume |
1090.38 ± 0.07 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0945 |
| Residual factor for significantly intense reflections |
0.0465 |
| Weighted residual factors for significantly intense reflections |
0.1059 |
| Weighted residual factors for all reflections included in the refinement |
0.1302 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.006 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7034838.html
