Information card for entry 7035508
| Formula |
C24 H27 B F2 N4 |
| Calculated formula |
C24 H27 B F2 N4 |
| SMILES |
[B]1(F)(F)n2c(c(c(c2c2c(c3c(c(c(C)[nH]3)CC)C)nc3ccccc3[n]12)C)CC)C |
| Title of publication |
Dipyrrolylquinoxaline difluoroborates with intense red solid-state fluorescence. |
| Authors of publication |
Yu, Changjiang; Hao, Erhong; Li, Tingting; Wang, Jun; Sheng, Wanle; Wei, Yun; Mu, Xiaolong; Jiao, Lijuan |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2015 |
| Journal volume |
44 |
| Journal issue |
31 |
| Pages of publication |
13897 - 13905 |
| a |
8.7229 ± 0.0014 Å |
| b |
9.6603 ± 0.0015 Å |
| c |
15.144 ± 0.002 Å |
| α |
91.398 ± 0.002° |
| β |
106.187 ± 0.002° |
| γ |
112.231 ± 0.002° |
| Cell volume |
1122.3 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1781 |
| Residual factor for significantly intense reflections |
0.058 |
| Weighted residual factors for significantly intense reflections |
0.0866 |
| Weighted residual factors for all reflections included in the refinement |
0.1173 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.978 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7035508.html