Information card for entry 7037848
| Formula |
C4 H8 N10 O2 |
| Calculated formula |
C4 H8 N10 O2 |
| SMILES |
c1([O-])nncn1N=Nn1c(=O)[nH]nc1.N[NH3+] |
| Title of publication |
Nitrogen-rich 4,4'-azo bis(1,2,4-triazolone) salts-the synthesis and promising properties of a new family of high-density insensitive materials. |
| Authors of publication |
Zhu, Jiaping; Jin, Shaohua; Wan, Li; Zhang, Chunyuan; Li, Lijie; Chen, Shusen; Shu, Qinghai |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2016 |
| Journal volume |
45 |
| Journal issue |
8 |
| Pages of publication |
3590 - 3598 |
| a |
7.7212 ± 0.0005 Å |
| b |
8.2866 ± 0.0005 Å |
| c |
8.3755 ± 0.0005 Å |
| α |
62.684 ± 0.001° |
| β |
71.571 ± 0.001° |
| γ |
83.253 ± 0.001° |
| Cell volume |
451.47 ± 0.05 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0398 |
| Residual factor for significantly intense reflections |
0.0359 |
| Weighted residual factors for significantly intense reflections |
0.0962 |
| Weighted residual factors for all reflections included in the refinement |
0.0998 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7037848.html