Information card for entry 7040273
| Formula |
C10 H10 O2 S2 |
| Calculated formula |
C10 H10 O2 S2 |
| SMILES |
S=C(SC)/C=C(O)/c1cccc(O)c1 |
| Title of publication |
Platinum(ii) O,S complexes as potential metallodrugs against Cisplatin resistance. |
| Authors of publication |
Hildebrandt, Jana; Häfner, Norman; Görls, Helmar; Kritsch, Daniel; Ferraro, Giarita; Dürst, Matthias; Runnebaum, Ingo B.; Merlino, Antonello; Weigand, Wolfgang |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2016 |
| Journal volume |
45 |
| Journal issue |
47 |
| Pages of publication |
18876 - 18891 |
| a |
3.9126 ± 0.0001 Å |
| b |
11.6243 ± 0.0005 Å |
| c |
22.2479 ± 0.0009 Å |
| α |
98.186 ± 0.002° |
| β |
90.339 ± 0.002° |
| γ |
94.31 ± 0.002° |
| Cell volume |
998.58 ± 0.06 Å3 |
| Cell temperature |
133 ± 2 K |
| Ambient diffraction temperature |
133 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0999 |
| Residual factor for significantly intense reflections |
0.0737 |
| Weighted residual factors for significantly intense reflections |
0.1367 |
| Weighted residual factors for all reflections included in the refinement |
0.1506 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.169 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7040273.html
