Information card for entry 7042167
| Formula |
C31 H33 B F4 N4 O2 |
| Calculated formula |
C31 H33 B F4 N4 O2 |
| SMILES |
C1=[N+](CCN1c1c(N2CCOCC2)ccc2ccccc12)c1c(N2CCOCC2)ccc2ccccc12.[B](F)(F)(F)[F-] |
| Title of publication |
New, potentially chelating NHC ligands; synthesis, complexation studies, and preliminary catalytic evaluation. |
| Authors of publication |
Ou, Arnold; Wu, Linglin; Salvador, Alvaro; Sipos, Gellert; Zhao, Guangzhen; Skelton, Brian W.; Sobolev, Alexandre N.; Dorta, Reto |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2017 |
| Journal volume |
46 |
| Journal issue |
11 |
| Pages of publication |
3631 - 3641 |
| a |
13.199 ± 0.0006 Å |
| b |
12.1266 ± 0.0004 Å |
| c |
18.1368 ± 0.0007 Å |
| α |
90° |
| β |
108.542 ± 0.004° |
| γ |
90° |
| Cell volume |
2752.3 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1241 |
| Residual factor for significantly intense reflections |
0.0634 |
| Weighted residual factors for significantly intense reflections |
0.1104 |
| Weighted residual factors for all reflections included in the refinement |
0.1324 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.977 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7042167.html