Information card for entry 7043780
| Formula |
C33 H36 B N2 O2 P |
| Calculated formula |
C33 H36 B N2 O2 P |
| SMILES |
C(=N\c1ccc(cc1)C)(N(c1ccc(cc1)C)B1OC(C(O1)(C)C)(C)C)/P(c1ccccc1)c1ccccc1 |
| Title of publication |
The Phosphinoboration of Carbodiimides, Isocyanates, Isothiocyanates and CO2 |
| Authors of publication |
Geier, Stephen; LaFortune, James; Zhu, Diya; Kosnik, Stephanie C.; Macdonald, Charles L. B.; Stephan, Douglas W.; Westcott, Steve |
| Journal of publication |
Dalton Trans. |
| Year of publication |
2017 |
| a |
9.6725 ± 0.0004 Å |
| b |
11.3305 ± 0.0004 Å |
| c |
14.4827 ± 0.0006 Å |
| α |
101.512 ± 0.002° |
| β |
100.403 ± 0.002° |
| γ |
101.893 ± 0.002° |
| Cell volume |
1480.67 ± 0.1 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0736 |
| Residual factor for significantly intense reflections |
0.043 |
| Weighted residual factors for significantly intense reflections |
0.0847 |
| Weighted residual factors for all reflections included in the refinement |
0.0961 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7043780.html