Information card for entry 7047640
| Formula |
C27 H20 B N O5 |
| Calculated formula |
C27 H20 B N O5 |
| SMILES |
O1C(=C(c2ccccc2)c2[n]([B]31Oc1c(C(=O)O3)cccc1)cccc2)c1ccc(OC)cc1 |
| Title of publication |
Solvatochromism, acidochromism and aggregation-induced emission of propeller-shaped spiroborates. |
| Authors of publication |
Li, Kang; Cui, Jichun; Yang, Zeren; Huo, Yanmin; Duan, Wenzeng; Gong, Shuwen; Liu, Zhipeng |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2018 |
| Journal volume |
47 |
| Journal issue |
42 |
| Pages of publication |
15002 - 15008 |
| a |
25.118 ± 0.0018 Å |
| b |
5.8625 ± 0.0004 Å |
| c |
15.0463 ± 0.0016 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2215.6 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0715 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for significantly intense reflections |
0.097 |
| Weighted residual factors for all reflections included in the refinement |
0.1083 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7047640.html