Information card for entry 7055102
| Formula |
C27 H23 N3 O |
| Calculated formula |
C27 H23 N3 O |
| SMILES |
O1N(C(N=C1N(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)C |
| Title of publication |
Zinc(ii)-mediated generation of 5-amino substituted 2,3-dihydro-1,2,4-oxadiazoles and their further ZnII-catalyzed and O2-involving transformations |
| Authors of publication |
Smirnov, Andrey S.; Yandanova, Ekaterina S.; Bokach, Nadezhda A.; Starova, Galina L.; Gurzhiy, Vladislav V.; Avdontceva, Margarita S.; Zolotarev, Andrey A.; Kukushkin, Vadim Yu. |
| Journal of publication |
New J. Chem. |
| Year of publication |
2015 |
| Journal volume |
39 |
| Journal issue |
12 |
| Pages of publication |
9330 |
| a |
22.9818 ± 0.0013 Å |
| b |
8.6205 ± 0.0003 Å |
| c |
23.3388 ± 0.001 Å |
| α |
90° |
| β |
114.188 ± 0.006° |
| γ |
90° |
| Cell volume |
4217.8 ± 0.4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1129 |
| Residual factor for significantly intense reflections |
0.0912 |
| Weighted residual factors for significantly intense reflections |
0.215 |
| Weighted residual factors for all reflections included in the refinement |
0.226 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.115 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7055102.html