Information card for entry 7055216
| Formula |
C10 H8 Cl N3 O2 |
| Calculated formula |
C10 H8 Cl N3 O2 |
| SMILES |
Clc1c(N/N=C\2C(=NOC2=O)C)cccc1 |
| Title of publication |
A family of substituted hydrazonoisoxazolones with potential biological properties |
| Authors of publication |
Bustos, Carlos; Molins, Elies; Cárcamo, Juan-Guillermo; Aguilar, Marcelo N.; Sánchez, Christian; Moreno-Villoslada, Ignacio; Nishide, Hiroyuki; Zarate, Ximena; Schott, Eduardo |
| Journal of publication |
New J. Chem. |
| Year of publication |
2016 |
| Journal volume |
40 |
| Journal issue |
3 |
| Pages of publication |
2156 |
| a |
7.642 Å |
| b |
7.933 Å |
| c |
9.511 Å |
| α |
98.77° |
| β |
104.53° |
| γ |
98.06° |
| Cell volume |
541.945 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1192 |
| Residual factor for significantly intense reflections |
0.0497 |
| Weighted residual factors for significantly intense reflections |
0.1158 |
| Weighted residual factors for all reflections included in the refinement |
0.1376 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.913 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7055216.html