Information card for entry 7102158
| Common name |
621 4-carboxy-PhC(CN)=NOH, 1-((4-pyridyl)methyl)-5,6-Me2- benzimidazole |
| Chemical name |
621 4-carboxy-PhC(CN)=NOH, 1-[(4-pyridyl)methyl]-5,6-Me2-benzimidazole |
| Formula |
C24 H21 N5 O3 |
| Calculated formula |
C24 H21 N5 O3 |
| SMILES |
n1(cnc2cc(c(cc12)C)C)Cc1ccncc1.c1(C(=O)O)ccc(cc1)C(=N\O)\C#N |
| Title of publication |
Constructing, deconstructing, and reconstructing ternary supermolecules. |
| Authors of publication |
Aakeröy, Christer B; Desper, John; Smith, Michelle M |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2007 |
| Journal issue |
38 |
| Pages of publication |
3936 - 3938 |
| a |
11.0553 ± 0.0013 Å |
| b |
7.3121 ± 0.0009 Å |
| c |
13.2662 ± 0.0017 Å |
| α |
90° |
| β |
94.693 ± 0.007° |
| γ |
90° |
| Cell volume |
1068.8 ± 0.2 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
7 |
| Hermann-Mauguin space group symbol |
P 1 c 1 |
| Hall space group symbol |
P -2yc |
| Residual factor for all reflections |
0.0563 |
| Residual factor for significantly intense reflections |
0.0527 |
| Weighted residual factors for significantly intense reflections |
0.1298 |
| Weighted residual factors for all reflections included in the refinement |
0.1346 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7102158.html