Information card for entry 7103289
| Common name |
(+)-5a-Methyl-2-(toluene-4-sulfonyl)-1,2,3,3a,4,5,5a,6- octahydro-7-oxa-2-aza-cyclopenta(c)phenanthrene |
| Formula |
C23 H25 N O3 S |
| Calculated formula |
C23 H25 N O3 S |
| SMILES |
S(=O)(=O)(N1C[C@H]2C(C1)=C1[C@@](CC2)(C)COc2ccccc12)c1ccc(cc1)C |
| Title of publication |
Rhodium-catalyzed enantio- and diastereoselective intramolecular [2 + 2 + 2] cycloaddition of unsymmetrical dienynes. |
| Authors of publication |
Sagae, Hiromi; Noguchi, Keiichi; Hirano, Masao; Tanaka, Ken |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2008 |
| Journal issue |
32 |
| Pages of publication |
3804 - 3806 |
| a |
6.41237 ± 0.00012 Å |
| b |
7.6149 ± 0.00014 Å |
| c |
20.4737 ± 0.0004 Å |
| α |
90° |
| β |
96.705 ± 0.001° |
| γ |
90° |
| Cell volume |
992.88 ± 0.03 Å3 |
| Cell temperature |
193 K |
| Ambient diffraction temperature |
193 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0288 |
| Residual factor for significantly intense reflections |
0.0278 |
| Weighted residual factors for significantly intense reflections |
0.0719 |
| Weighted residual factors for all reflections included in the refinement |
0.075 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.087 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7103289.html