Information card for entry 7105055
| Formula |
C22 H19 Cu N5 O9 |
| Calculated formula |
C22 H19 Cu N5 O9 |
| SMILES |
[Cu]12([n]3ccccc3C[N]1(Cc1[n]2cccc1)Cc1cc(=O)oc2cc(ccc12)O)ON(=O)=O.N(=O)(=O)[O-] |
| Title of publication |
Pyrophosphate selective fluorescent chemosensors based on coumarin-DPA-Cu(II) complexes. |
| Authors of publication |
Kim, Min Jung; Swamy, K M K; Lee, Kyung Mi; Jagdale, Arun R; Kim, Youngmee; Kim, Sung-Jin; Yoo, Kyung Ho; Yoon, Juyoung |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2009 |
| Journal issue |
46 |
| Pages of publication |
7215 - 7217 |
| a |
8.8036 ± 0.001 Å |
| b |
13.0269 ± 0.0015 Å |
| c |
19.063 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2186.2 ± 0.4 Å3 |
| Cell temperature |
170 ± 2 K |
| Ambient diffraction temperature |
170 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0676 |
| Residual factor for significantly intense reflections |
0.0421 |
| Weighted residual factors for significantly intense reflections |
0.0698 |
| Weighted residual factors for all reflections included in the refinement |
0.074 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.838 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7105055.html