Information card for entry 7106426
| Common name |
[Mn(pytren-4Q)](ClO4)2(H2O) |
| Formula |
C23 H32 Cl2 Mn N6 O9 |
| Calculated formula |
C23 H32 Cl2 Mn N6 O9 |
| SMILES |
[Mn]1234([OH2])[n]5c6C[NH]3CC[N]2(CC[NH]1Cc5ccc6)CC[NH]4Cc1ccnc2ccccc12.Cl(=O)(=O)(=O)[O-].Cl(=O)(=O)(=O)[O-] |
| Title of publication |
Manganese(II) complexes of scorpiand-like azamacrocycles as MnSOD mimics |
| Authors of publication |
Garcia-Espana, Enrique; Clares, Ma Paz; Blasco, Salvador; Inclan, Mario; Verdejo, Begona; del Castillo, Lucas; Soriano, Conxa; Domenech, Antonio; Latorre, Julio |
| Journal of publication |
Chem.Commun. |
| Year of publication |
2011 |
| Journal volume |
47 |
| Pages of publication |
5988 |
| a |
8.7809 ± 0.0004 Å |
| b |
15.2321 ± 0.0006 Å |
| c |
10.2323 ± 0.0005 Å |
| α |
90° |
| β |
94.03 ± 0.005° |
| γ |
90° |
| Cell volume |
1365.2 ± 0.11 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1278 |
| Residual factor for significantly intense reflections |
0.0746 |
| Weighted residual factors for significantly intense reflections |
0.1488 |
| Weighted residual factors for all reflections included in the refinement |
0.1806 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7106426.html