Information card for entry 7116289
| Chemical name |
2-(4-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| Formula |
C12 H15 B Br F O2 |
| Calculated formula |
C12 H15 B Br F O2 |
| SMILES |
Brc1ccc(B2OC(C)(C(O2)(C)C)C)c(F)c1 |
| Title of publication |
Regioselective electrophilic borylation of haloarenes. |
| Authors of publication |
Del Grosso, Alessandro; Ayuso Carrillo, Josue; Ingleson, Michael J. |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2015 |
| Journal volume |
51 |
| Journal issue |
14 |
| Pages of publication |
2878 |
| a |
13.8821 ± 0.0008 Å |
| b |
7.6711 ± 0.0004 Å |
| c |
12.4528 ± 0.0006 Å |
| α |
90° |
| β |
92.002 ± 0.005° |
| γ |
90° |
| Cell volume |
1325.3 ± 0.12 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0747 |
| Residual factor for significantly intense reflections |
0.0523 |
| Weighted residual factors for significantly intense reflections |
0.0995 |
| Weighted residual factors for all reflections included in the refinement |
0.1105 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7116289.html