Information card for entry 7120313
| Chemical name |
di-tert-butyl (3R,3'R,5'R)-2-oxo-2',3'-diphenylspiro[indoline-3,4'-isoxazolidine]-1,5'-dicarboxylate |
| Formula |
C32 H34 N2 O6 |
| Calculated formula |
C32 H34 N2 O6 |
| SMILES |
O1N(c2ccccc2)[C@H](c2ccccc2)[C@]2([C@@H]1C(=O)OC(C)(C)C)C(=O)N(C(=O)OC(C)(C)C)c1c2cccc1 |
| Title of publication |
Chiral N,N’-Dioxide/Co(II)-Promoted Asymmetric 1,3-Dipolar Cycloaddition of Nitrones with Methyleneindolinones |
| Authors of publication |
Zhang, Dong; Yin, Chengkai; Zhou, Yuhang; Xu, Yali; Lin, Lili; Liu, Xiaohua; Feng, Xiaoming |
| Journal of publication |
Chem. Commun. |
| Year of publication |
2017 |
| a |
10.21904 ± 0.00012 Å |
| b |
11.88874 ± 0.00013 Å |
| c |
24.5399 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2981.39 ± 0.06 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0514 |
| Residual factor for significantly intense reflections |
0.049 |
| Weighted residual factors for significantly intense reflections |
0.1309 |
| Weighted residual factors for all reflections included in the refinement |
0.1343 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7120313.html