Information card for entry 7126392
| Formula |
C20 H20 N2 O3 |
| Calculated formula |
C20 H20 N2 O3 |
| SMILES |
O(C(=O)C1=C(NCc2ccccc2)Nc2ccc(cc2C1=O)C)CC |
| Title of publication |
A three-component reaction of phosphorus ylides with isocyanates: facile synthesis of 2-amino-3-carboxylate-4-quinolones. |
| Authors of publication |
Babu, Kaki Raveendra; Han, Wendan; Chen, Jian-Bo; Li, Yang; Tang, Yuhai; Zhang, Wenquan; Xu, Wenbo; Xu, Silong |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2020 |
| Journal volume |
56 |
| Journal issue |
44 |
| Pages of publication |
5909 - 5912 |
| a |
8.842 ± 0.0013 Å |
| b |
13.473 ± 0.002 Å |
| c |
14.699 ± 0.002 Å |
| α |
83.102 ± 0.002° |
| β |
79.47 ± 0.002° |
| γ |
89.425 ± 0.002° |
| Cell volume |
1709 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0824 |
| Residual factor for significantly intense reflections |
0.0504 |
| Weighted residual factors for significantly intense reflections |
0.125 |
| Weighted residual factors for all reflections included in the refinement |
0.1424 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7126392.html
