Information card for entry 7127329
| Chemical name |
(2,3,4,5,6-pentamethylphenyl)(1,8,8-trimethylbicyclo[3.2.1]octan-3-yl)methanone |
| Formula |
C23 H34 O |
| Calculated formula |
C23 H34 O |
| SMILES |
O=C([C@@H]1C[C@@]2(C([C@@H](CC2)C1)(C)C)C)c1c(c(c(c(c1C)C)C)C)C |
| Title of publication |
A phosphine-free iron complex-catalyzed synthesis of cycloalkanes <i>via</i> the borrowing hydrogen strategy. |
| Authors of publication |
Bettoni, Léo; Gaillard, Sylvain; Renaud, Jean-Luc |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2020 |
| Journal volume |
56 |
| Journal issue |
85 |
| Pages of publication |
12909 - 12912 |
| a |
6.689 ± 0.004 Å |
| b |
10.95 ± 0.006 Å |
| c |
13.04 ± 0.01 Å |
| α |
90° |
| β |
94.67 ± 0.05° |
| γ |
90° |
| Cell volume |
951.9 ± 1.1 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.102 |
| Residual factor for significantly intense reflections |
0.0575 |
| Weighted residual factors for significantly intense reflections |
0.1086 |
| Weighted residual factors for all reflections included in the refinement |
0.1227 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.984 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7127329.html