Information card for entry 7129778
| Formula |
C24 H18 Br N3 O4 S |
| Calculated formula |
C24 H18 Br N3 O4 S |
| SMILES |
Brc1ccc(c2[nH]c(N(=O)=O)c3c2CN(S(=O)(=O)c2ccc(cc2)C)c2c3cccc2)cc1 |
| Title of publication |
Nitrative bicyclization of 1,7-diynes for accessing skeletally diverse tricyclic pyrroles |
| Authors of publication |
Wang, Lu; Zhang, Yin; Miao, An-Qi; Zhang, Tian-Shu; Wang, Xiang; Hao, Wen-Juan; Tu, Shu-Jiang; Jiang, Bo |
| Journal of publication |
Chemical Communications |
| Year of publication |
2022 |
| a |
7.0233 ± 0.0009 Å |
| b |
21.02 ± 0.002 Å |
| c |
15.0121 ± 0.0015 Å |
| α |
90° |
| β |
103.257 ± 0.004° |
| γ |
90° |
| Cell volume |
2157.2 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.2401 |
| Residual factor for significantly intense reflections |
0.0779 |
| Weighted residual factors for significantly intense reflections |
0.1017 |
| Weighted residual factors for all reflections included in the refinement |
0.1312 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.785 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7129778.html