Information card for entry 7130842
| Formula |
C22 H15 N3 O2 |
| Calculated formula |
C22 H15 N3 O2 |
| SMILES |
O=C1N(C(=O)c2c3c(ccc2)C(c2c3c1ccc2)=C(C#N)C#N)CCCC |
| Title of publication |
A Class of Electron-Deficient Units: Fluorenone Imide and Its Electron-Withdrawing Group-Functionalized Derivatives |
| Authors of publication |
Chen, Zhicai; Zhang, Yu; Wang, Pu; Yang, Jiaxin; Yang, Kun; Li, Jianfeng; Yang, Jie; Li, Yongchun; Dong, Huanli; Guo, Xugang |
| Journal of publication |
Chemical Communications |
| Year of publication |
2022 |
| a |
10.224 ± 0.0009 Å |
| b |
43.467 ± 0.004 Å |
| c |
7.785 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3459.7 ± 0.5 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
45 |
| Hermann-Mauguin space group symbol |
I b a 2 |
| Hall space group symbol |
I 2 -2c |
| Residual factor for all reflections |
0.0805 |
| Residual factor for significantly intense reflections |
0.0578 |
| Weighted residual factors for significantly intense reflections |
0.1571 |
| Weighted residual factors for all reflections included in the refinement |
0.1783 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.161 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7130842.html