Information card for entry 7150071
| Common name |
(4aR,7R,8S,8aS)-4a,5,6,7,8,8a-Hexahydro-7,8-isopropano-4a- methyl-1,3-dithiolo (4,5-b)(1,4)benzodithiin-2-thione |
| Chemical name |
(4aR,7R,8S,8aS)-4a,5,6,7,8,8a-Hexahydro-7,8-isopropano-4a-methyl-1,3-dithiolo [4,5-b][1,4]benzodithiin-2-thione |
| Formula |
C13 H16 S5 |
| Calculated formula |
C13 H16 S5 |
| SMILES |
S=C1SC2S[C@]3([C@@H](SC=2S1)[C@@H]1C([C@@H]1CC3)(C)C)C |
| Title of publication |
Synthetic strategies to chiral organosulfur donors related to bis(ethylenedithio)tetrathiafulvalene. |
| Authors of publication |
Griffiths, Jon-Paul; Nie, Hui; Brown, R. James; Day, Peter; Wallis, John D. |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2005 |
| Journal volume |
3 |
| Journal issue |
11 |
| Pages of publication |
2155 - 2166 |
| a |
7.609 ± 0.0001 Å |
| b |
9.789 ± 0.0002 Å |
| c |
20.1711 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1502.43 ± 0.05 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0283 |
| Residual factor for significantly intense reflections |
0.0253 |
| Weighted residual factors for significantly intense reflections |
0.0594 |
| Weighted residual factors for all reflections included in the refinement |
0.0603 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7150071.html