Information card for entry 7150442
| Common name |
6-Ethylamino-2-methyl-1-azaxanthone |
| Chemical name |
6-Ethylamino-2-methyl-1-azaxanthone |
| Formula |
C15 H14 N2 O2 |
| Calculated formula |
C15 H14 N2 O2 |
| SMILES |
O=C1c2ccc(nc2Oc2c1c(NCC)ccc2)C |
| Title of publication |
Azaxanthones and azathioxanthones are effective sensitisers for europium and terbium luminescence. |
| Authors of publication |
Atkinson, Paul; Findlay, Karen S.; Kielar, Filip; Pal, Robert; Parker, David; Poole, Robert A.; Puschmann, Horst; Richardson, Siobhan L.; Stenson, Philip A.; Thompson, Amber L.; Yu, Junhau |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2006 |
| Journal volume |
4 |
| Journal issue |
9 |
| Pages of publication |
1707 - 1722 |
| a |
4.584 ± 0.0003 Å |
| b |
11.1889 ± 0.0007 Å |
| c |
24.2034 ± 0.0015 Å |
| α |
90° |
| β |
90.953 ± 0.003° |
| γ |
90° |
| Cell volume |
1241.22 ± 0.14 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1531 |
| Residual factor for significantly intense reflections |
0.056 |
| Weighted residual factors for significantly intense reflections |
0.1174 |
| Weighted residual factors for all reflections included in the refinement |
0.1502 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.867 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7150442.html
