Information card for entry 7150853
| Common name |
2,5'-Di((E)-benzylidene)-(1,2,3,4-tetrahydronaphthalen-1-one) 4-spiro-3'-(piperidine-2',6'-dione) |
| Chemical name |
2,5'-Di[(E)-benzylidene]-[1,2,3,4-tetrahydronaphthalen-1-one] 4-spiro-3'-[piperidine-2',6'-dione] |
| Formula |
C28 H21 N O3 |
| Calculated formula |
C28 H21 N O3 |
| SMILES |
O=C1c2c(cccc2)C2(C/C1=C\c1ccccc1)CC(=C\c1ccccc1)/C(=O)NC2=O |
| Title of publication |
Simple and facile synthesis of tetralone-spiro-glutarimides and spiro-bisglutarimides from Baylis–Hillman acetates |
| Authors of publication |
Basavaiah, Deevi; Reddy, Raju Jannapu |
| Journal of publication |
Organic & Biomolecular Chemistry |
| Year of publication |
2008 |
| Journal volume |
6 |
| Journal issue |
6 |
| Pages of publication |
1034 - 1039 |
| a |
9.0369 ± 0.0018 Å |
| b |
25.751 ± 0.005 Å |
| c |
9.274 ± 0.0018 Å |
| α |
90° |
| β |
96.108 ± 0.003° |
| γ |
90° |
| Cell volume |
2145.9 ± 0.7 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0528 |
| Residual factor for significantly intense reflections |
0.0427 |
| Weighted residual factors for significantly intense reflections |
0.1031 |
| Weighted residual factors for all reflections included in the refinement |
0.1081 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7150853.html